C19H22ClF2N3O2 — CID 119373495
(4-aminopiperidin-1-yl)-[2-[4-(difluoromethoxy)anilino]phenyl]methanone;hydrochloride (PubChem CID 119373495) has the molecular formula C19H22ClF2N3O2 and a molecular weight of 397.85 g/mol. Its IUPAC name is (4-aminopiperidin-1-yl)-[2-[4-(difluoromethoxy)anilino]phenyl]methanone;hydrochloride.
| Compound Name | (4-aminopiperidin-1-yl)-[2-[4-(difluoromethoxy)anilino]phenyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119373495 |
| Molecular Formula | C19H22ClF2N3O2 |
| Molecular Weight | 397.85 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | (4-aminopiperidin-1-yl)-[2-[4-(difluoromethoxy)anilino]phenyl]methanone;hydrochloride |
| SMILES | Cl.NC1CCN(C(=O)c2ccccc2Nc2ccc(OC(F)F)cc2)CC1 |
| InChI | InChI=1S/C19H21F2N3O2.ClH/c20-19(21)26-15-7-5-14(6-8-15)23-17-4-2-1-3-16(17)18(25)24-11-9-13(22)10-12-24;/h1-8,13,19,23H,9-12,22H2;1H |
| InChIKey | NVMNACBLKNJCGR-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.85 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |