C21H25F2N3O2 — CID 56532436
[2-[4-(difluoromethoxy)anilino]phenyl]-[3-(dimethylamino)piperidin-1-yl]methanone (PubChem CID 56532436) has the molecular formula C21H25F2N3O2 and a molecular weight of 389.45 g/mol. Its IUPAC name is [2-[4-(difluoromethoxy)anilino]phenyl]-[3-(dimethylamino)piperidin-1-yl]methanone.
| Compound Name | [2-[4-(difluoromethoxy)anilino]phenyl]-[3-(dimethylamino)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 56532436 |
| Molecular Formula | C21H25F2N3O2 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | [2-[4-(difluoromethoxy)anilino]phenyl]-[3-(dimethylamino)piperidin-1-yl]methanone |
| SMILES | CN(C)C1CCCN(C(=O)c2ccccc2Nc2ccc(OC(F)F)cc2)C1 |
| InChI | InChI=1S/C21H25F2N3O2/c1-25(2)16-6-5-13-26(14-16)20(27)18-7-3-4-8-19(18)24-15-9-11-17(12-10-15)28-21(22)23/h3-4,7-12,16,21,24H,5-6,13-14H2,1-2H3 |
| InChIKey | UXPGQUXVVVPKOH-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |