C19H21F2N3O2 — CID 119425043
2-[4-(difluoromethoxy)anilino]-N-piperidin-3-ylbenzamide (PubChem CID 119425043) has the molecular formula C19H21F2N3O2 and a molecular weight of 361.39 g/mol. Its IUPAC name is 2-[4-(difluoromethoxy)anilino]-N-piperidin-3-ylbenzamide.
| Compound Name | 2-[4-(difluoromethoxy)anilino]-N-piperidin-3-ylbenzamide |
|---|---|
| PubChem CID | 119425043 |
| Molecular Formula | C19H21F2N3O2 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 2-[4-(difluoromethoxy)anilino]-N-piperidin-3-ylbenzamide |
| SMILES | O=C(NC1CCCNC1)c1ccccc1Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C19H21F2N3O2/c20-19(21)26-15-9-7-13(8-10-15)23-17-6-2-1-5-16(17)18(25)24-14-4-3-11-22-12-14/h1-2,5-10,14,19,22-23H,3-4,11-12H2,(H,24,25) |
| InChIKey | ISXHOTQEWXMBKJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |