C20H21F2N3O3 — CID 51210779
1-[4-[2-[4-(difluoromethoxy)anilino]benzoyl]piperazin-1-yl]ethanone (PubChem CID 51210779) has the molecular formula C20H21F2N3O3 and a molecular weight of 389.40 g/mol. Its IUPAC name is 1-[4-[2-[4-(difluoromethoxy)anilino]benzoyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[2-[4-(difluoromethoxy)anilino]benzoyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 51210779 |
| Molecular Formula | C20H21F2N3O3 |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 1-[4-[2-[4-(difluoromethoxy)anilino]benzoyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(C(=O)c2ccccc2Nc2ccc(OC(F)F)cc2)CC1 |
| InChI | InChI=1S/C20H21F2N3O3/c1-14(26)24-10-12-25(13-11-24)19(27)17-4-2-3-5-18(17)23-15-6-8-16(9-7-15)28-20(21)22/h2-9,20,23H,10-13H2,1H3 |
| InChIKey | GGYVRRQVXGHZBV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |