C11H14ClIN2OS — CID 120657361
[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(5-iodothiophen-3-yl)methanone;hydrochloride (PubChem CID 120657361) has the molecular formula C11H14ClIN2OS and a molecular weight of 384.67 g/mol. Its IUPAC name is [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(5-iodothiophen-3-yl)methanone;hydrochloride.
| Compound Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(5-iodothiophen-3-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120657361 |
| Molecular Formula | C11H14ClIN2OS |
| Molecular Weight | 384.67 g/mol |
| Exact Mass | 383.96 |
| IUPAC Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(5-iodothiophen-3-yl)methanone;hydrochloride |
| SMILES | Cl.O=C(c1csc(I)c1)N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C11H13IN2OS.ClH/c12-10-1-7(6-16-10)11(15)14-4-8-2-13-3-9(8)5-14;/h1,6,8-9,13H,2-5H2;1H/t8-,9+; |
| InChIKey | FVMJSXPIPSFXSH-UFIFRZAQSA-N |
| XLogP | 2.07 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.67 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|