C11H16ClIN2OS — CID 119564307
(3,5-dimethylpiperazin-1-yl)-(5-iodothiophen-3-yl)methanone;hydrochloride (PubChem CID 119564307) has the molecular formula C11H16ClIN2OS and a molecular weight of 386.69 g/mol. Its IUPAC name is (3,5-dimethylpiperazin-1-yl)-(5-iodothiophen-3-yl)methanone;hydrochloride.
| Compound Name | (3,5-dimethylpiperazin-1-yl)-(5-iodothiophen-3-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119564307 |
| Molecular Formula | C11H16ClIN2OS |
| Molecular Weight | 386.69 g/mol |
| Exact Mass | 385.97 |
| IUPAC Name | (3,5-dimethylpiperazin-1-yl)-(5-iodothiophen-3-yl)methanone;hydrochloride |
| SMILES | CC1CN(C(=O)c2csc(I)c2)CC(C)N1.Cl |
| InChI | InChI=1S/C11H15IN2OS.ClH/c1-7-4-14(5-8(2)13-7)11(15)9-3-10(12)16-6-9;/h3,6-8,13H,4-5H2,1-2H3;1H |
| InChIKey | DTRNGRVJAWYWIP-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.69 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|