C13H16ClF3N2O — CID 119564732
(3,5-dimethylpiperazin-1-yl)-(3,4,5-trifluorophenyl)methanone;hydrochloride (PubChem CID 119564732) has the molecular formula C13H16ClF3N2O and a molecular weight of 308.73 g/mol. Its IUPAC name is (3,5-dimethylpiperazin-1-yl)-(3,4,5-trifluorophenyl)methanone;hydrochloride.
| Compound Name | (3,5-dimethylpiperazin-1-yl)-(3,4,5-trifluorophenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119564732 |
| Molecular Formula | C13H16ClF3N2O |
| Molecular Weight | 308.73 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | (3,5-dimethylpiperazin-1-yl)-(3,4,5-trifluorophenyl)methanone;hydrochloride |
| SMILES | CC1CN(C(=O)c2cc(F)c(F)c(F)c2)CC(C)N1.Cl |
| InChI | InChI=1S/C13H15F3N2O.ClH/c1-7-5-18(6-8(2)17-7)13(19)9-3-10(14)12(16)11(15)4-9;/h3-4,7-8,17H,5-6H2,1-2H3;1H |
| InChIKey | QWVOAVMFIKZIDT-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.73 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|