C12H14INO3S — CID 122118299
1-(5-iodothiophene-3-carbonyl)-5-methylpiperidine-3-carboxylic acid (PubChem CID 122118299) has the molecular formula C12H14INO3S and a molecular weight of 379.22 g/mol. Its IUPAC name is 1-(5-iodothiophene-3-carbonyl)-5-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-(5-iodothiophene-3-carbonyl)-5-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122118299 |
| Molecular Formula | C12H14INO3S |
| Molecular Weight | 379.22 g/mol |
| Exact Mass | 378.97 |
| IUPAC Name | 1-(5-iodothiophene-3-carbonyl)-5-methylpiperidine-3-carboxylic acid |
| SMILES | CC1CC(C(=O)O)CN(C(=O)c2csc(I)c2)C1 |
| InChI | InChI=1S/C12H14INO3S/c1-7-2-8(12(16)17)5-14(4-7)11(15)9-3-10(13)18-6-9/h3,6-8H,2,4-5H2,1H3,(H,16,17) |
| InChIKey | MFCXTLFWRNIYSJ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.22 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|