C13H14INO3S — CID 120978348
(3R,4R)-4-cyclopropyl-1-(5-iodothiophene-3-carbonyl)pyrrolidine-3-carboxylic acid (PubChem CID 120978348) has the molecular formula C13H14INO3S and a molecular weight of 391.23 g/mol. Its IUPAC name is (3R,4R)-4-cyclopropyl-1-(5-iodothiophene-3-carbonyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (3R,4R)-4-cyclopropyl-1-(5-iodothiophene-3-carbonyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 120978348 |
| Molecular Formula | C13H14INO3S |
| Molecular Weight | 391.23 g/mol |
| Exact Mass | 390.97 |
| IUPAC Name | (3R,4R)-4-cyclopropyl-1-(5-iodothiophene-3-carbonyl)pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)[C@H]1CN(C(=O)c2csc(I)c2)C[C@@H]1C1CC1 |
| InChI | InChI=1S/C13H14INO3S/c14-11-3-8(6-19-11)12(16)15-4-9(7-1-2-7)10(5-15)13(17)18/h3,6-7,9-10H,1-2,4-5H2,(H,17,18)/t9-,10+/m1/s1 |
| InChIKey | LYRJCKAUFZOUNL-ZJUUUORDSA-N |
| XLogP | 2.54 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.23 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|