C12H17N3O2S — CID 124590095
5-[(3R,5R)-3,5-dimethylpiperazine-1-carbonyl]thiophene-3-carboxamide (PubChem CID 124590095) has the molecular formula C12H17N3O2S and a molecular weight of 267.35 g/mol. Its IUPAC name is 5-[(3R,5R)-3,5-dimethylpiperazine-1-carbonyl]thiophene-3-carboxamide.
| Compound Name | 5-[(3R,5R)-3,5-dimethylpiperazine-1-carbonyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 124590095 |
| Molecular Formula | C12H17N3O2S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 5-[(3R,5R)-3,5-dimethylpiperazine-1-carbonyl]thiophene-3-carboxamide |
| SMILES | C[C@@H]1CN(C(=O)c2cc(C(N)=O)cs2)C[C@@H](C)N1 |
| InChI | InChI=1S/C12H17N3O2S/c1-7-4-15(5-8(2)14-7)12(17)10-3-9(6-18-10)11(13)16/h3,6-8,14H,4-5H2,1-2H3,(H2,13,16)/t7-,8-/m1/s1 |
| InChIKey | KTECJNIICMGPLS-HTQZYQBOSA-N |
| XLogP | 0.67 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |