C19H23N3O2S — CID 136527442
5-(4-benzyl-2-methyl-1,4-diazepane-1-carbonyl)thiophene-3-carboxamide (PubChem CID 136527442) has the molecular formula C19H23N3O2S and a molecular weight of 357.48 g/mol. Its IUPAC name is 5-(4-benzyl-2-methyl-1,4-diazepane-1-carbonyl)thiophene-3-carboxamide.
| Compound Name | 5-(4-benzyl-2-methyl-1,4-diazepane-1-carbonyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 136527442 |
| Molecular Formula | C19H23N3O2S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 5-(4-benzyl-2-methyl-1,4-diazepane-1-carbonyl)thiophene-3-carboxamide |
| SMILES | CC1CN(Cc2ccccc2)CCCN1C(=O)c1cc(C(N)=O)cs1 |
| InChI | InChI=1S/C19H23N3O2S/c1-14-11-21(12-15-6-3-2-4-7-15)8-5-9-22(14)19(24)17-10-16(13-25-17)18(20)23/h2-4,6-7,10,13-14H,5,8-9,11-12H2,1H3,(H2,20,23) |
| InChIKey | RIZFRLSSKYUZDQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |