C21H25N3O2S — CID 164631595
5-[(5R)-9-benzyl-2,9-diazaspiro[4.5]decane-2-carbonyl]thiophene-3-carboxamide (PubChem CID 164631595) has the molecular formula C21H25N3O2S and a molecular weight of 383.52 g/mol. Its IUPAC name is 5-[(5R)-9-benzyl-2,9-diazaspiro[4.5]decane-2-carbonyl]thiophene-3-carboxamide.
| Compound Name | 5-[(5R)-9-benzyl-2,9-diazaspiro[4.5]decane-2-carbonyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 164631595 |
| Molecular Formula | C21H25N3O2S |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 5-[(5R)-9-benzyl-2,9-diazaspiro[4.5]decane-2-carbonyl]thiophene-3-carboxamide |
| SMILES | NC(=O)c1csc(C(=O)N2CC[C@@]3(CCCN(Cc4ccccc4)C3)C2)c1 |
| InChI | InChI=1S/C21H25N3O2S/c22-19(25)17-11-18(27-13-17)20(26)24-10-8-21(15-24)7-4-9-23(14-21)12-16-5-2-1-3-6-16/h1-3,5-6,11,13H,4,7-10,12,14-15H2,(H2,22,25)/t21-/m1/s1 |
| InChIKey | XJAHRISABDOHME-OAQYLSRUSA-N |
| XLogP | 2.98 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |