C22H25N3O3 — CID 166254868
5-(9-benzyl-2,9-diazaspiro[4.5]decane-2-carbonyl)pyridine-3-carboxylic acid (PubChem CID 166254868) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is 5-(9-benzyl-2,9-diazaspiro[4.5]decane-2-carbonyl)pyridine-3-carboxylic acid.
| Compound Name | 5-(9-benzyl-2,9-diazaspiro[4.5]decane-2-carbonyl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 166254868 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 5-(9-benzyl-2,9-diazaspiro[4.5]decane-2-carbonyl)pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cncc(C(=O)N2CCC3(CCCN(Cc4ccccc4)C3)C2)c1 |
| InChI | InChI=1S/C22H25N3O3/c26-20(18-11-19(21(27)28)13-23-12-18)25-10-8-22(16-25)7-4-9-24(15-22)14-17-5-2-1-3-6-17/h1-3,5-6,11-13H,4,7-10,14-16H2,(H,27,28) |
| InChIKey | NEQPAYRIEKERMW-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |