C18H18N2O3S — CID 97041948
5-[(2R)-2-phenacylpyrrolidine-1-carbonyl]thiophene-3-carboxamide (PubChem CID 97041948) has the molecular formula C18H18N2O3S and a molecular weight of 342.42 g/mol. Its IUPAC name is 5-[(2R)-2-phenacylpyrrolidine-1-carbonyl]thiophene-3-carboxamide.
| Compound Name | 5-[(2R)-2-phenacylpyrrolidine-1-carbonyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 97041948 |
| Molecular Formula | C18H18N2O3S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 5-[(2R)-2-phenacylpyrrolidine-1-carbonyl]thiophene-3-carboxamide |
| SMILES | NC(=O)c1csc(C(=O)N2CCC[C@@H]2CC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C18H18N2O3S/c19-17(22)13-9-16(24-11-13)18(23)20-8-4-7-14(20)10-15(21)12-5-2-1-3-6-12/h1-3,5-6,9,11,14H,4,7-8,10H2,(H2,19,22)/t14-/m1/s1 |
| InChIKey | IHMYXOKPKLKCMI-CQSZACIVSA-N |
| XLogP | 2.72 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |