C21H21NO3 — CID 75425281
2-[1-(4-acetylbenzoyl)pyrrolidin-2-yl]-1-phenylethanone (PubChem CID 75425281) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is 2-[1-(4-acetylbenzoyl)pyrrolidin-2-yl]-1-phenylethanone.
| Compound Name | 2-[1-(4-acetylbenzoyl)pyrrolidin-2-yl]-1-phenylethanone |
|---|---|
| PubChem CID | 75425281 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 2-[1-(4-acetylbenzoyl)pyrrolidin-2-yl]-1-phenylethanone |
| SMILES | CC(=O)c1ccc(C(=O)N2CCCC2CC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H21NO3/c1-15(23)16-9-11-18(12-10-16)21(25)22-13-5-8-19(22)14-20(24)17-6-3-2-4-7-17/h2-4,6-7,9-12,19H,5,8,13-14H2,1H3 |
| InChIKey | GDPWOLKZZLTBSZ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |