C25H29NO4 — CID 96533586
2-[(2R)-1-[2-(5-acetyl-2-methoxyphenyl)acetyl]azepan-2-yl]-1-phenylethanone (PubChem CID 96533586) has the molecular formula C25H29NO4 and a molecular weight of 407.51 g/mol. Its IUPAC name is 2-[(2R)-1-[2-(5-acetyl-2-methoxyphenyl)acetyl]azepan-2-yl]-1-phenylethanone.
| Compound Name | 2-[(2R)-1-[2-(5-acetyl-2-methoxyphenyl)acetyl]azepan-2-yl]-1-phenylethanone |
|---|---|
| PubChem CID | 96533586 |
| Molecular Formula | C25H29NO4 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | 2-[(2R)-1-[2-(5-acetyl-2-methoxyphenyl)acetyl]azepan-2-yl]-1-phenylethanone |
| SMILES | COc1ccc(C(C)=O)cc1CC(=O)N1CCCCC[C@@H]1CC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H29NO4/c1-18(27)20-12-13-24(30-2)21(15-20)16-25(29)26-14-8-4-7-11-22(26)17-23(28)19-9-5-3-6-10-19/h3,5-6,9-10,12-13,15,22H,4,7-8,11,14,16-17H2,1-2H3/t22-/m1/s1 |
| InChIKey | DDOHMONRXPEICM-JOCHJYFZSA-N |
| XLogP | 4.48 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |