C18H25NO4 — CID 71911930
2-(5-acetyl-2-methoxyphenyl)-1-[2-(2-hydroxypropan-2-yl)pyrrolidin-1-yl]ethanone (PubChem CID 71911930) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is 2-(5-acetyl-2-methoxyphenyl)-1-[2-(2-hydroxypropan-2-yl)pyrrolidin-1-yl]ethanone.
| Compound Name | 2-(5-acetyl-2-methoxyphenyl)-1-[2-(2-hydroxypropan-2-yl)pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 71911930 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 2-(5-acetyl-2-methoxyphenyl)-1-[2-(2-hydroxypropan-2-yl)pyrrolidin-1-yl]ethanone |
| SMILES | COc1ccc(C(C)=O)cc1CC(=O)N1CCCC1C(C)(C)O |
| InChI | InChI=1S/C18H25NO4/c1-12(20)13-7-8-15(23-4)14(10-13)11-17(21)19-9-5-6-16(19)18(2,3)22/h7-8,10,16,22H,5-6,9,11H2,1-4H3 |
| InChIKey | NNYHUSYEENSTNG-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |