C17H17NO2S — CID 97041732
1-phenyl-2-[(2S)-1-(thiophene-3-carbonyl)pyrrolidin-2-yl]ethanone (PubChem CID 97041732) has the molecular formula C17H17NO2S and a molecular weight of 299.39 g/mol. Its IUPAC name is 1-phenyl-2-[(2S)-1-(thiophene-3-carbonyl)pyrrolidin-2-yl]ethanone.
| Compound Name | 1-phenyl-2-[(2S)-1-(thiophene-3-carbonyl)pyrrolidin-2-yl]ethanone |
|---|---|
| PubChem CID | 97041732 |
| Molecular Formula | C17H17NO2S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 1-phenyl-2-[(2S)-1-(thiophene-3-carbonyl)pyrrolidin-2-yl]ethanone |
| SMILES | O=C(C[C@@H]1CCCN1C(=O)c1ccsc1)c1ccccc1 |
| InChI | InChI=1S/C17H17NO2S/c19-16(13-5-2-1-3-6-13)11-15-7-4-9-18(15)17(20)14-8-10-21-12-14/h1-3,5-6,8,10,12,15H,4,7,9,11H2/t15-/m0/s1 |
| InChIKey | MDOCCPDGRVUOOZ-HNNXBMFYSA-N |
| XLogP | 3.63 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |