C21H20N2O2 — CID 97041772
2-[3-[(2S)-2-phenacylpyrrolidine-1-carbonyl]phenyl]acetonitrile (PubChem CID 97041772) has the molecular formula C21H20N2O2 and a molecular weight of 332.40 g/mol. Its IUPAC name is 2-[3-[(2S)-2-phenacylpyrrolidine-1-carbonyl]phenyl]acetonitrile.
| Compound Name | 2-[3-[(2S)-2-phenacylpyrrolidine-1-carbonyl]phenyl]acetonitrile |
|---|---|
| PubChem CID | 97041772 |
| Molecular Formula | C21H20N2O2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 2-[3-[(2S)-2-phenacylpyrrolidine-1-carbonyl]phenyl]acetonitrile |
| SMILES | N#CCc1cccc(C(=O)N2CCC[C@H]2CC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C21H20N2O2/c22-12-11-16-6-4-9-18(14-16)21(25)23-13-5-10-19(23)15-20(24)17-7-2-1-3-8-17/h1-4,6-9,14,19H,5,10-11,13,15H2/t19-/m0/s1 |
| InChIKey | WAZVRLNVHKSNRL-IBGZPJMESA-N |
| XLogP | 3.63 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |