C19H25N3O — CID 98761490
2-[3-[(2R)-2-[(2R)-1-ethylpyrrolidin-2-yl]pyrrolidine-1-carbonyl]phenyl]acetonitrile (PubChem CID 98761490) has the molecular formula C19H25N3O and a molecular weight of 311.43 g/mol. Its IUPAC name is 2-[3-[(2R)-2-[(2R)-1-ethylpyrrolidin-2-yl]pyrrolidine-1-carbonyl]phenyl]acetonitrile.
| Compound Name | 2-[3-[(2R)-2-[(2R)-1-ethylpyrrolidin-2-yl]pyrrolidine-1-carbonyl]phenyl]acetonitrile |
|---|---|
| PubChem CID | 98761490 |
| Molecular Formula | C19H25N3O |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | 2-[3-[(2R)-2-[(2R)-1-ethylpyrrolidin-2-yl]pyrrolidine-1-carbonyl]phenyl]acetonitrile |
| SMILES | CCN1CCC[C@@H]1[C@H]1CCCN1C(=O)c1cccc(CC#N)c1 |
| InChI | InChI=1S/C19H25N3O/c1-2-21-12-4-8-17(21)18-9-5-13-22(18)19(23)16-7-3-6-15(14-16)10-11-20/h3,6-7,14,17-18H,2,4-5,8-10,12-13H2,1H3/t17-,18-/m1/s1 |
| InChIKey | ZZSVVAPLSOEUIW-QZTJIDSGSA-N |
| XLogP | 2.84 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |