About 2-[3-[(3S)-3-[(1R,2R)-2-hydroxycyclopentyl]morpholine-4-carbonyl]phenyl]acetonitrile
2-[3-[(3S)-3-[(1R,2R)-2-hydroxycyclopentyl]morpholine-4-carbonyl]phenyl]acetonitrile (PubChem CID 129346739) has the molecular formula C18H22N2O3
and a molecular weight of 314.38 g/mol. Its IUPAC name is 2-[3-[(3S)-3-[(1R,2R)-2-hydroxycyclopentyl]morpholine-4-carbonyl]phenyl]acetonitrile.
Molecular Properties
| Compound Name | 2-[3-[(3S)-3-[(1R,2R)-2-hydroxycyclopentyl]morpholine-4-carbonyl]phenyl]acetonitrile |
| PubChem CID | 129346739 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 2-[3-[(3S)-3-[(1R,2R)-2-hydroxycyclopentyl]morpholine-4-carbonyl]phenyl]acetonitrile |
| SMILES | N#CCc1cccc(C(=O)N2CCOC[C@@H]2[C@H]2CCC[C@H]2O)c1 |
| InChI | InChI=1S/C18H22N2O3/c19-8-7-13-3-1-4-14(11-13)18(22)20-9-10-23-12-16(20)15-5-2-6-17(15)21/h1,3-4,11,15-17,21H,2,5-7,9-10,12H2/t15-,16-,17-/m1/s1 |
| InChIKey | YAYSYWOFEHQSCP-BRWVUGGUSA-N |
| XLogP | 1.75 |
| TPSA | 73.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[3-[(3S)-3-[(1R,2R)-2-hydroxycyclopentyl]morpholine-4-carbonyl]phenyl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[(3S)-3-[(1R,2R)-2-hydroxycyclopentyl]morpholine-4-carbonyl]phenyl]acetonitrile?
The IUPAC name of 2-[3-[(3S)-3-[(1R,2R)-2-hydroxycyclopentyl]morpholine-4-carbonyl]phenyl]acetonitrile (CID 129346739) is 2-[3-[(3S)-3-[(1R,2R)-2-hydroxycyclopentyl]morpholine-4-carbonyl]phenyl]acetonitrile.
What is the SMILES notation for 2-[3-[(3S)-3-[(1R,2R)-2-hydroxycyclopentyl]morpholine-4-carbonyl]phenyl]acetonitrile?
The canonical SMILES for 2-[3-[(3S)-3-[(1R,2R)-2-hydroxycyclopentyl]morpholine-4-carbonyl]phenyl]acetonitrile is N#CCc1cccc(C(=O)N2CCOC[C@@H]2[C@H]2CCC[C@H]2O)c1.
What is the InChIKey of 2-[3-[(3S)-3-[(1R,2R)-2-hydroxycyclopentyl]morpholine-4-carbonyl]phenyl]acetonitrile?
The InChIKey is YAYSYWOFEHQSCP-BRWVUGGUSA-N. The full InChI is InChI=1S/C18H22N2O3/c19-8-7-13-3-1-4-14(11-13)18(22)20-9-10-23-12-16(20)15-5-2-6-17(15)21/h1,3-4,11,15-17,21H,2,5-7,9-10,12H2/t15-,16-,17-/m1/s1.
What are the key properties of 2-[3-[(3S)-3-[(1R,2R)-2-hydroxycyclopentyl]morpholine-4-carbonyl]phenyl]acetonitrile?
2-[3-[(3S)-3-[(1R,2R)-2-hydroxycyclopentyl]morpholine-4-carbonyl]phenyl]acetonitrile has a molecular weight of 314.38 g/mol, XLogP of 1.75, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[(3S)-3-[(1R,2R)-2-hydroxycyclopentyl]morpholine-4-carbonyl]phenyl]acetonitrile is sourced from PubChem (CID 129346739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).