C18H22N2O4 — CID 128987967
2-[2-[3-(2-hydroxycyclopentyl)morpholin-4-yl]-2-oxoethoxy]benzonitrile (PubChem CID 128987967) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 2-[2-[3-(2-hydroxycyclopentyl)morpholin-4-yl]-2-oxoethoxy]benzonitrile.
| Compound Name | 2-[2-[3-(2-hydroxycyclopentyl)morpholin-4-yl]-2-oxoethoxy]benzonitrile |
|---|---|
| PubChem CID | 128987967 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 2-[2-[3-(2-hydroxycyclopentyl)morpholin-4-yl]-2-oxoethoxy]benzonitrile |
| SMILES | N#Cc1ccccc1OCC(=O)N1CCOCC1C1CCCC1O |
| InChI | InChI=1S/C18H22N2O4/c19-10-13-4-1-2-7-17(13)24-12-18(22)20-8-9-23-11-15(20)14-5-3-6-16(14)21/h1-2,4,7,14-16,21H,3,5-6,8-9,11-12H2 |
| InChIKey | ZWRDEYFWBFYUKX-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 82.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |