C14H16N2O3 — CID 93044931
2-[2-[(3S)-3-methylmorpholin-4-yl]-2-oxoethoxy]benzonitrile (PubChem CID 93044931) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is 2-[2-[(3S)-3-methylmorpholin-4-yl]-2-oxoethoxy]benzonitrile.
| Compound Name | 2-[2-[(3S)-3-methylmorpholin-4-yl]-2-oxoethoxy]benzonitrile |
|---|---|
| PubChem CID | 93044931 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 2-[2-[(3S)-3-methylmorpholin-4-yl]-2-oxoethoxy]benzonitrile |
| SMILES | C[C@H]1COCCN1C(=O)COc1ccccc1C#N |
| InChI | InChI=1S/C14H16N2O3/c1-11-9-18-7-6-16(11)14(17)10-19-13-5-3-2-4-12(13)8-15/h2-5,11H,6-7,9-10H2,1H3/t11-/m0/s1 |
| InChIKey | IVLAVAFMEZXIPU-NSHDSACASA-N |
| XLogP | 1.18 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |