C15H18N2O3 — CID 35026256
2-[2-(2,2-dimethylmorpholin-4-yl)-2-oxoethoxy]benzonitrile (PubChem CID 35026256) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is 2-[2-(2,2-dimethylmorpholin-4-yl)-2-oxoethoxy]benzonitrile.
| Compound Name | 2-[2-(2,2-dimethylmorpholin-4-yl)-2-oxoethoxy]benzonitrile |
|---|---|
| PubChem CID | 35026256 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 2-[2-(2,2-dimethylmorpholin-4-yl)-2-oxoethoxy]benzonitrile |
| SMILES | CC1(C)CN(C(=O)COc2ccccc2C#N)CCO1 |
| InChI | InChI=1S/C15H18N2O3/c1-15(2)11-17(7-8-20-15)14(18)10-19-13-6-4-3-5-12(13)9-16/h3-6H,7-8,10-11H2,1-2H3 |
| InChIKey | CCCLHZDEHZESLS-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |