C15H18N2O3 — CID 102738509
2-[2-[2-(hydroxymethyl)-3-methylpyrrolidin-1-yl]-2-oxoethoxy]benzonitrile (PubChem CID 102738509) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is 2-[2-[2-(hydroxymethyl)-3-methylpyrrolidin-1-yl]-2-oxoethoxy]benzonitrile.
| Compound Name | 2-[2-[2-(hydroxymethyl)-3-methylpyrrolidin-1-yl]-2-oxoethoxy]benzonitrile |
|---|---|
| PubChem CID | 102738509 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 2-[2-[2-(hydroxymethyl)-3-methylpyrrolidin-1-yl]-2-oxoethoxy]benzonitrile |
| SMILES | CC1CCN(C(=O)COc2ccccc2C#N)C1CO |
| InChI | InChI=1S/C15H18N2O3/c1-11-6-7-17(13(11)9-18)15(19)10-20-14-5-3-2-4-12(14)8-16/h2-5,11,13,18H,6-7,9-10H2,1H3 |
| InChIKey | ADLGMVONFREIHV-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 73.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |