C17H19N3O3 — CID 120954900
2-[2-[(4aR,7aS)-6-methyl-5-oxo-2,3,4,4a,7,7a-hexahydropyrrolo[3,4-b]pyridin-1-yl]-2-oxoethoxy]benzonitrile (PubChem CID 120954900) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is 2-[2-[(4aR,7aS)-6-methyl-5-oxo-2,3,4,4a,7,7a-hexahydropyrrolo[3,4-b]pyridin-1-yl]-2-oxoethoxy]benzonitrile.
| Compound Name | 2-[2-[(4aR,7aS)-6-methyl-5-oxo-2,3,4,4a,7,7a-hexahydropyrrolo[3,4-b]pyridin-1-yl]-2-oxoethoxy]benzonitrile |
|---|---|
| PubChem CID | 120954900 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 2-[2-[(4aR,7aS)-6-methyl-5-oxo-2,3,4,4a,7,7a-hexahydropyrrolo[3,4-b]pyridin-1-yl]-2-oxoethoxy]benzonitrile |
| SMILES | CN1C[C@@H]2[C@@H](CCCN2C(=O)COc2ccccc2C#N)C1=O |
| InChI | InChI=1S/C17H19N3O3/c1-19-10-14-13(17(19)22)6-4-8-20(14)16(21)11-23-15-7-3-2-5-12(15)9-18/h2-3,5,7,13-14H,4,6,8,10-11H2,1H3/t13-,14-/m1/s1 |
| InChIKey | ZRTYLVSGBONWIP-ZIAGYGMSSA-N |
| XLogP | 1.02 |
| TPSA | 73.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |