C16H17F3N2O2 — CID 120954932
(4aR,7aS)-6-methyl-1-[2-(2,4,5-trifluorophenyl)acetyl]-2,3,4,4a,7,7a-hexahydropyrrolo[3,4-b]pyridin-5-one (PubChem CID 120954932) has the molecular formula C16H17F3N2O2 and a molecular weight of 326.32 g/mol. Its IUPAC name is (4aR,7aS)-6-methyl-1-[2-(2,4,5-trifluorophenyl)acetyl]-2,3,4,4a,7,7a-hexahydropyrrolo[3,4-b]pyridin-5-one.
| Compound Name | (4aR,7aS)-6-methyl-1-[2-(2,4,5-trifluorophenyl)acetyl]-2,3,4,4a,7,7a-hexahydropyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 120954932 |
| Molecular Formula | C16H17F3N2O2 |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | (4aR,7aS)-6-methyl-1-[2-(2,4,5-trifluorophenyl)acetyl]-2,3,4,4a,7,7a-hexahydropyrrolo[3,4-b]pyridin-5-one |
| SMILES | CN1C[C@@H]2[C@@H](CCCN2C(=O)Cc2cc(F)c(F)cc2F)C1=O |
| InChI | InChI=1S/C16H17F3N2O2/c1-20-8-14-10(16(20)23)3-2-4-21(14)15(22)6-9-5-12(18)13(19)7-11(9)17/h5,7,10,14H,2-4,6,8H2,1H3/t10-,14-/m1/s1 |
| InChIKey | UQSDZYDOQIGLPA-QMTHXVAHSA-N |
| XLogP | 1.73 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|