C13H13F2NO3 — CID 96667389
(2R)-1-[2-(2,5-difluorophenyl)acetyl]pyrrolidine-2-carboxylic acid (PubChem CID 96667389) has the molecular formula C13H13F2NO3 and a molecular weight of 269.25 g/mol. Its IUPAC name is (2R)-1-[2-(2,5-difluorophenyl)acetyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-[2-(2,5-difluorophenyl)acetyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 96667389 |
| Molecular Formula | C13H13F2NO3 |
| Molecular Weight | 269.25 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | (2R)-1-[2-(2,5-difluorophenyl)acetyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCCN1C(=O)Cc1cc(F)ccc1F |
| InChI | InChI=1S/C13H13F2NO3/c14-9-3-4-10(15)8(6-9)7-12(17)16-5-1-2-11(16)13(18)19/h3-4,6,11H,1-2,5,7H2,(H,18,19)/t11-/m1/s1 |
| InChIKey | NWECKAGQELUQDH-LLVKDONJSA-N |
| XLogP | 1.58 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.25 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |