C16H21FN2O3S — CID 120913787
(4aR,7aS)-1-[(3-fluoro-4-methylphenyl)methylsulfonyl]-6-methyl-2,3,4,4a,7,7a-hexahydropyrrolo[3,4-b]pyridin-5-one (PubChem CID 120913787) has the molecular formula C16H21FN2O3S and a molecular weight of 340.42 g/mol. Its IUPAC name is (4aR,7aS)-1-[(3-fluoro-4-methylphenyl)methylsulfonyl]-6-methyl-2,3,4,4a,7,7a-hexahydropyrrolo[3,4-b]pyridin-5-one.
| Compound Name | (4aR,7aS)-1-[(3-fluoro-4-methylphenyl)methylsulfonyl]-6-methyl-2,3,4,4a,7,7a-hexahydropyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 120913787 |
| Molecular Formula | C16H21FN2O3S |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | (4aR,7aS)-1-[(3-fluoro-4-methylphenyl)methylsulfonyl]-6-methyl-2,3,4,4a,7,7a-hexahydropyrrolo[3,4-b]pyridin-5-one |
| SMILES | Cc1ccc(CS(=O)(=O)N2CCC[C@H]3C(=O)N(C)C[C@H]32)cc1F |
| InChI | InChI=1S/C16H21FN2O3S/c1-11-5-6-12(8-14(11)17)10-23(21,22)19-7-3-4-13-15(19)9-18(2)16(13)20/h5-6,8,13,15H,3-4,7,9-10H2,1-2H3/t13-,15-/m1/s1 |
| InChIKey | KDZUISPPDMOQJO-UKRRQHHQSA-N |
| XLogP | 1.52 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |