C12H13ClFNO4S — CID 122069646
(2R)-1-[(4-chloro-3-fluorophenyl)methylsulfonyl]pyrrolidine-2-carboxylic acid (PubChem CID 122069646) has the molecular formula C12H13ClFNO4S and a molecular weight of 321.76 g/mol. Its IUPAC name is (2R)-1-[(4-chloro-3-fluorophenyl)methylsulfonyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-[(4-chloro-3-fluorophenyl)methylsulfonyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 122069646 |
| Molecular Formula | C12H13ClFNO4S |
| Molecular Weight | 321.76 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | (2R)-1-[(4-chloro-3-fluorophenyl)methylsulfonyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCCN1S(=O)(=O)Cc1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C12H13ClFNO4S/c13-9-4-3-8(6-10(9)14)7-20(18,19)15-5-1-2-11(15)12(16)17/h3-4,6,11H,1-2,5,7H2,(H,16,17)/t11-/m1/s1 |
| InChIKey | HAMMKQYPGJAEIO-LLVKDONJSA-N |
| XLogP | 1.86 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.76 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |