C14H16N2O2S — CID 56813489
2-[2-oxo-2-(1,4-thiazepan-4-yl)ethoxy]benzonitrile (PubChem CID 56813489) has the molecular formula C14H16N2O2S and a molecular weight of 276.36 g/mol. Its IUPAC name is 2-[2-oxo-2-(1,4-thiazepan-4-yl)ethoxy]benzonitrile.
| Compound Name | 2-[2-oxo-2-(1,4-thiazepan-4-yl)ethoxy]benzonitrile |
|---|---|
| PubChem CID | 56813489 |
| Molecular Formula | C14H16N2O2S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 2-[2-oxo-2-(1,4-thiazepan-4-yl)ethoxy]benzonitrile |
| SMILES | N#Cc1ccccc1OCC(=O)N1CCCSCC1 |
| InChI | InChI=1S/C14H16N2O2S/c15-10-12-4-1-2-5-13(12)18-11-14(17)16-6-3-8-19-9-7-16/h1-2,4-5H,3,6-9,11H2 |
| InChIKey | MYWCZJWQCNZIHE-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |