C18H19ClF4N2O — CID 119504852
N-[2-(ethylamino)ethyl]-5-fluoro-2-[3-(trifluoromethyl)phenyl]benzamide;hydrochloride (PubChem CID 119504852) has the molecular formula C18H19ClF4N2O and a molecular weight of 390.81 g/mol. Its IUPAC name is N-[2-(ethylamino)ethyl]-5-fluoro-2-[3-(trifluoromethyl)phenyl]benzamide;hydrochloride.
| Compound Name | N-[2-(ethylamino)ethyl]-5-fluoro-2-[3-(trifluoromethyl)phenyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119504852 |
| Molecular Formula | C18H19ClF4N2O |
| Molecular Weight | 390.81 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | N-[2-(ethylamino)ethyl]-5-fluoro-2-[3-(trifluoromethyl)phenyl]benzamide;hydrochloride |
| SMILES | CCNCCNC(=O)c1cc(F)ccc1-c1cccc(C(F)(F)F)c1.Cl |
| InChI | InChI=1S/C18H18F4N2O.ClH/c1-2-23-8-9-24-17(25)16-11-14(19)6-7-15(16)12-4-3-5-13(10-12)18(20,21)22;/h3-7,10-11,23H,2,8-9H2,1H3,(H,24,25);1H |
| InChIKey | FRJVDHDQRFSTCG-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.81 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|