C19H18F4N2O2 — CID 120943802
5-fluoro-N-[(4-hydroxypyrrolidin-3-yl)methyl]-2-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 120943802) has the molecular formula C19H18F4N2O2 and a molecular weight of 382.36 g/mol. Its IUPAC name is 5-fluoro-N-[(4-hydroxypyrrolidin-3-yl)methyl]-2-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 5-fluoro-N-[(4-hydroxypyrrolidin-3-yl)methyl]-2-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 120943802 |
| Molecular Formula | C19H18F4N2O2 |
| Molecular Weight | 382.36 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 5-fluoro-N-[(4-hydroxypyrrolidin-3-yl)methyl]-2-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(NCC1CNCC1O)c1cc(F)ccc1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H18F4N2O2/c20-14-4-5-15(11-2-1-3-13(6-11)19(21,22)23)16(7-14)18(27)25-9-12-8-24-10-17(12)26/h1-7,12,17,24,26H,8-10H2,(H,25,27) |
| InChIKey | ATJQPDZRRFOBQQ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |