C22H20FN3O — CID 120655430
[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(7-fluoro-2-phenylquinolin-4-yl)methanone (PubChem CID 120655430) has the molecular formula C22H20FN3O and a molecular weight of 361.42 g/mol. Its IUPAC name is [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(7-fluoro-2-phenylquinolin-4-yl)methanone.
| Compound Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(7-fluoro-2-phenylquinolin-4-yl)methanone |
|---|---|
| PubChem CID | 120655430 |
| Molecular Formula | C22H20FN3O |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(7-fluoro-2-phenylquinolin-4-yl)methanone |
| SMILES | O=C(c1cc(-c2ccccc2)nc2cc(F)ccc12)N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C22H20FN3O/c23-17-6-7-18-19(22(27)26-12-15-10-24-11-16(15)13-26)9-20(25-21(18)8-17)14-4-2-1-3-5-14/h1-9,15-16,24H,10-13H2/t15-,16+ |
| InChIKey | SRRFVMMWUIKKMK-IYBDPMFKSA-N |
| XLogP | 3.33 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |