C14H14F4N2O — CID 120655536
[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[3-fluoro-5-(trifluoromethyl)phenyl]methanone (PubChem CID 120655536) has the molecular formula C14H14F4N2O and a molecular weight of 302.27 g/mol. Its IUPAC name is [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[3-fluoro-5-(trifluoromethyl)phenyl]methanone.
| Compound Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[3-fluoro-5-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 120655536 |
| Molecular Formula | C14H14F4N2O |
| Molecular Weight | 302.27 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[3-fluoro-5-(trifluoromethyl)phenyl]methanone |
| SMILES | O=C(c1cc(F)cc(C(F)(F)F)c1)N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C14H14F4N2O/c15-12-2-8(1-11(3-12)14(16,17)18)13(21)20-6-9-4-19-5-10(9)7-20/h1-3,9-10,19H,4-7H2/t9-,10+ |
| InChIKey | LQUKMALZTQRGFL-AOOOYVTPSA-N |
| XLogP | 2.14 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.27 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |