C14H15ClF4N2O — CID 120660150
[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[4-fluoro-3-(trifluoromethyl)phenyl]methanone;hydrochloride (PubChem CID 120660150) has the molecular formula C14H15ClF4N2O and a molecular weight of 338.73 g/mol. Its IUPAC name is [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[4-fluoro-3-(trifluoromethyl)phenyl]methanone;hydrochloride.
| Compound Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[4-fluoro-3-(trifluoromethyl)phenyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 120660150 |
| Molecular Formula | C14H15ClF4N2O |
| Molecular Weight | 338.73 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[4-fluoro-3-(trifluoromethyl)phenyl]methanone;hydrochloride |
| SMILES | Cl.O=C(c1ccc(F)c(C(F)(F)F)c1)N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C14H14F4N2O.ClH/c15-12-2-1-8(3-11(12)14(16,17)18)13(21)20-6-9-4-19-5-10(9)7-20;/h1-3,9-10,19H,4-7H2;1H/t9-,10+; |
| InChIKey | SLHXMTKIOYQSAM-JMVWIVNTSA-N |
| XLogP | 2.56 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.73 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |