C22H21F3N2O — CID 151299396
N-[3-(methylamino)propyl]-5-[4-(trifluoromethyl)phenyl]naphthalene-2-carboxamide (PubChem CID 151299396) has the molecular formula C22H21F3N2O and a molecular weight of 386.42 g/mol. Its IUPAC name is N-[3-(methylamino)propyl]-5-[4-(trifluoromethyl)phenyl]naphthalene-2-carboxamide.
| Compound Name | N-[3-(methylamino)propyl]-5-[4-(trifluoromethyl)phenyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 151299396 |
| Molecular Formula | C22H21F3N2O |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | N-[3-(methylamino)propyl]-5-[4-(trifluoromethyl)phenyl]naphthalene-2-carboxamide |
| SMILES | CNCCCNC(=O)c1ccc2c(-c3ccc(C(F)(F)F)cc3)cccc2c1 |
| InChI | InChI=1S/C22H21F3N2O/c1-26-12-3-13-27-21(28)17-8-11-20-16(14-17)4-2-5-19(20)15-6-9-18(10-7-15)22(23,24)25/h2,4-11,14,26H,3,12-13H2,1H3,(H,27,28) |
| InChIKey | OCCFRLOKFKEERT-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|