C21H19F3N2O3 — CID 155713246
N-ethyl-5-[4-(trifluoromethyl)phenoxy]naphthalene-2-carboxamide;formamide (PubChem CID 155713246) has the molecular formula C21H19F3N2O3 and a molecular weight of 404.39 g/mol. Its IUPAC name is N-ethyl-5-[4-(trifluoromethyl)phenoxy]naphthalene-2-carboxamide;formamide.
| Compound Name | N-ethyl-5-[4-(trifluoromethyl)phenoxy]naphthalene-2-carboxamide;formamide |
|---|---|
| PubChem CID | 155713246 |
| Molecular Formula | C21H19F3N2O3 |
| Molecular Weight | 404.39 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | N-ethyl-5-[4-(trifluoromethyl)phenoxy]naphthalene-2-carboxamide;formamide |
| SMILES | CCNC(=O)c1ccc2c(Oc3ccc(C(F)(F)F)cc3)cccc2c1.NC=O |
| InChI | InChI=1S/C20H16F3NO2.CH3NO/c1-2-24-19(25)14-6-11-17-13(12-14)4-3-5-18(17)26-16-9-7-15(8-10-16)20(21,22)23;2-1-3/h3-12H,2H2,1H3,(H,24,25);1H,(H2,2,3) |
| InChIKey | MIONZVBBBLHAFJ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.39 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|