C36H39F3N2O3 — CID 177202072
N-[[3-[2-(nonylamino)-2-oxoethyl]phenyl]methyl]-5-[4-(trifluoromethyl)phenoxy]naphthalene-2-carboxamide (PubChem CID 177202072) has the molecular formula C36H39F3N2O3 and a molecular weight of 604.71 g/mol. Its IUPAC name is N-[[3-[2-(nonylamino)-2-oxoethyl]phenyl]methyl]-5-[4-(trifluoromethyl)phenoxy]naphthalene-2-carboxamide.
| Compound Name | N-[[3-[2-(nonylamino)-2-oxoethyl]phenyl]methyl]-5-[4-(trifluoromethyl)phenoxy]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 177202072 |
| Molecular Formula | C36H39F3N2O3 |
| Molecular Weight | 604.71 g/mol |
| Exact Mass | 604.29 |
| IUPAC Name | N-[[3-[2-(nonylamino)-2-oxoethyl]phenyl]methyl]-5-[4-(trifluoromethyl)phenoxy]naphthalene-2-carboxamide |
| SMILES | CCCCCCCCCNC(=O)Cc1cccc(CNC(=O)c2ccc3c(Oc4ccc(C(F)(F)F)cc4)cccc3c2)c1 |
| InChI | InChI=1S/C36H39F3N2O3/c1-2-3-4-5-6-7-8-21-40-34(42)23-26-11-9-12-27(22-26)25-41-35(43)29-15-20-32-28(24-29)13-10-14-33(32)44-31-18-16-30(17-19-31)36(37,38)39/h9-20,22,24H,2-8,21,23,25H2,1H3,(H,40,42)(H,41,43) |
| InChIKey | MLIPUXCAYFKEJE-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.71 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|