C27H25NO2 — CID 177202079
N-[(3-ethylphenyl)methyl]-5-(4-methylphenoxy)naphthalene-2-carboxamide (PubChem CID 177202079) has the molecular formula C27H25NO2 and a molecular weight of 395.50 g/mol. Its IUPAC name is N-[(3-ethylphenyl)methyl]-5-(4-methylphenoxy)naphthalene-2-carboxamide.
| Compound Name | N-[(3-ethylphenyl)methyl]-5-(4-methylphenoxy)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 177202079 |
| Molecular Formula | C27H25NO2 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | N-[(3-ethylphenyl)methyl]-5-(4-methylphenoxy)naphthalene-2-carboxamide |
| SMILES | CCc1cccc(CNC(=O)c2ccc3c(Oc4ccc(C)cc4)cccc3c2)c1 |
| InChI | InChI=1S/C27H25NO2/c1-3-20-6-4-7-21(16-20)18-28-27(29)23-12-15-25-22(17-23)8-5-9-26(25)30-24-13-10-19(2)11-14-24/h4-17H,3,18H2,1-2H3,(H,28,29) |
| InChIKey | RFDBDGFRMUVJKR-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |