C20H18N2O3 — CID 25256330
2-N-hydroxy-6-N-[(3-methylphenyl)methyl]naphthalene-2,6-dicarboxamide (PubChem CID 25256330) has the molecular formula C20H18N2O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is 2-N-hydroxy-6-N-[(3-methylphenyl)methyl]naphthalene-2,6-dicarboxamide.
| Compound Name | 2-N-hydroxy-6-N-[(3-methylphenyl)methyl]naphthalene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 25256330 |
| Molecular Formula | C20H18N2O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 2-N-hydroxy-6-N-[(3-methylphenyl)methyl]naphthalene-2,6-dicarboxamide |
| SMILES | Cc1cccc(CNC(=O)c2ccc3cc(C(=O)NO)ccc3c2)c1 |
| InChI | InChI=1S/C20H18N2O3/c1-13-3-2-4-14(9-13)12-21-19(23)17-7-5-16-11-18(20(24)22-25)8-6-15(16)10-17/h2-11,25H,12H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | NFXDGYNOFVBNEA-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|