C16H16BrNO — CID 80979004
2-bromo-5-methyl-N-[(3-methylphenyl)methyl]benzamide (PubChem CID 80979004) has the molecular formula C16H16BrNO and a molecular weight of 318.21 g/mol. Its IUPAC name is 2-bromo-5-methyl-N-[(3-methylphenyl)methyl]benzamide.
| Compound Name | 2-bromo-5-methyl-N-[(3-methylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 80979004 |
| Molecular Formula | C16H16BrNO |
| Molecular Weight | 318.21 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 2-bromo-5-methyl-N-[(3-methylphenyl)methyl]benzamide |
| SMILES | Cc1cccc(CNC(=O)c2cc(C)ccc2Br)c1 |
| InChI | InChI=1S/C16H16BrNO/c1-11-4-3-5-13(8-11)10-18-16(19)14-9-12(2)6-7-15(14)17/h3-9H,10H2,1-2H3,(H,18,19) |
| InChIKey | MVANMPQCPBHVCI-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.21 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |