C19H11F3N2O2 — CID 155214031
N-cyano-5-[4-(trifluoromethyl)phenoxy]naphthalene-2-carboxamide (PubChem CID 155214031) has the molecular formula C19H11F3N2O2 and a molecular weight of 356.30 g/mol. Its IUPAC name is N-cyano-5-[4-(trifluoromethyl)phenoxy]naphthalene-2-carboxamide.
| Compound Name | N-cyano-5-[4-(trifluoromethyl)phenoxy]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 155214031 |
| Molecular Formula | C19H11F3N2O2 |
| Molecular Weight | 356.30 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | N-cyano-5-[4-(trifluoromethyl)phenoxy]naphthalene-2-carboxamide |
| SMILES | N#CNC(=O)c1ccc2c(Oc3ccc(C(F)(F)F)cc3)cccc2c1 |
| InChI | InChI=1S/C19H11F3N2O2/c20-19(21,22)14-5-7-15(8-6-14)26-17-3-1-2-12-10-13(4-9-16(12)17)18(25)24-11-23/h1-10H,(H,24,25) |
| InChIKey | JWDVWKUKVFHHES-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.30 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|