C27H20F3NO3 — CID 155214182
N-(3-phenyloxetan-3-yl)-5-[4-(trifluoromethyl)phenoxy]naphthalene-2-carboxamide (PubChem CID 155214182) has the molecular formula C27H20F3NO3 and a molecular weight of 463.46 g/mol. Its IUPAC name is N-(3-phenyloxetan-3-yl)-5-[4-(trifluoromethyl)phenoxy]naphthalene-2-carboxamide.
| Compound Name | N-(3-phenyloxetan-3-yl)-5-[4-(trifluoromethyl)phenoxy]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 155214182 |
| Molecular Formula | C27H20F3NO3 |
| Molecular Weight | 463.46 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | N-(3-phenyloxetan-3-yl)-5-[4-(trifluoromethyl)phenoxy]naphthalene-2-carboxamide |
| SMILES | O=C(NC1(c2ccccc2)COC1)c1ccc2c(Oc3ccc(C(F)(F)F)cc3)cccc2c1 |
| InChI | InChI=1S/C27H20F3NO3/c28-27(29,30)21-10-12-22(13-11-21)34-24-8-4-5-18-15-19(9-14-23(18)24)25(32)31-26(16-33-17-26)20-6-2-1-3-7-20/h1-15H,16-17H2,(H,31,32) |
| InChIKey | YVLKPHIVJFXINU-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.46 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |