C26H28F3NO2 — CID 177062751
(4S)-6-(ethylamino)-4-methyl-1-[5-[4-(trifluoromethyl)phenoxy]naphthalen-2-yl]hexan-1-one (PubChem CID 177062751) has the molecular formula C26H28F3NO2 and a molecular weight of 443.51 g/mol. Its IUPAC name is (4S)-6-(ethylamino)-4-methyl-1-[5-[4-(trifluoromethyl)phenoxy]naphthalen-2-yl]hexan-1-one.
| Compound Name | (4S)-6-(ethylamino)-4-methyl-1-[5-[4-(trifluoromethyl)phenoxy]naphthalen-2-yl]hexan-1-one |
|---|---|
| PubChem CID | 177062751 |
| Molecular Formula | C26H28F3NO2 |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | (4S)-6-(ethylamino)-4-methyl-1-[5-[4-(trifluoromethyl)phenoxy]naphthalen-2-yl]hexan-1-one |
| SMILES | CCNCC[C@@H](C)CCC(=O)c1ccc2c(Oc3ccc(C(F)(F)F)cc3)cccc2c1 |
| InChI | InChI=1S/C26H28F3NO2/c1-3-30-16-15-18(2)7-14-24(31)20-8-13-23-19(17-20)5-4-6-25(23)32-22-11-9-21(10-12-22)26(27,28)29/h4-6,8-13,17-18,30H,3,7,14-16H2,1-2H3/t18-/m0/s1 |
| InChIKey | WXCSGBNYHZCEKF-SFHVURJKSA-N |
| XLogP | 7.25 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|