C26H26F5NO2 — CID 155223387
(4S)-6-(2,2-difluoroethylamino)-4-methyl-1-[5-[4-(trifluoromethyl)phenoxy]naphthalen-2-yl]hexan-1-one (PubChem CID 155223387) has the molecular formula C26H26F5NO2 and a molecular weight of 479.49 g/mol. Its IUPAC name is (4S)-6-(2,2-difluoroethylamino)-4-methyl-1-[5-[4-(trifluoromethyl)phenoxy]naphthalen-2-yl]hexan-1-one.
| Compound Name | (4S)-6-(2,2-difluoroethylamino)-4-methyl-1-[5-[4-(trifluoromethyl)phenoxy]naphthalen-2-yl]hexan-1-one |
|---|---|
| PubChem CID | 155223387 |
| Molecular Formula | C26H26F5NO2 |
| Molecular Weight | 479.49 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | (4S)-6-(2,2-difluoroethylamino)-4-methyl-1-[5-[4-(trifluoromethyl)phenoxy]naphthalen-2-yl]hexan-1-one |
| SMILES | C[C@H](CCNCC(F)F)CCC(=O)c1ccc2c(Oc3ccc(C(F)(F)F)cc3)cccc2c1 |
| InChI | InChI=1S/C26H26F5NO2/c1-17(13-14-32-16-25(27)28)5-12-23(33)19-6-11-22-18(15-19)3-2-4-24(22)34-21-9-7-20(8-10-21)26(29,30)31/h2-4,6-11,15,17,25,32H,5,12-14,16H2,1H3/t17-/m0/s1 |
| InChIKey | MCSRNBMYPCKNAH-KRWDZBQOSA-N |
| XLogP | 7.49 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.49 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|