C24H24F3NO2 — CID 155223381
(4S)-6-amino-4-methyl-1-[5-[4-(trifluoromethyl)phenoxy]naphthalen-2-yl]hexan-1-one (PubChem CID 155223381) has the molecular formula C24H24F3NO2 and a molecular weight of 415.46 g/mol. Its IUPAC name is (4S)-6-amino-4-methyl-1-[5-[4-(trifluoromethyl)phenoxy]naphthalen-2-yl]hexan-1-one.
| Compound Name | (4S)-6-amino-4-methyl-1-[5-[4-(trifluoromethyl)phenoxy]naphthalen-2-yl]hexan-1-one |
|---|---|
| PubChem CID | 155223381 |
| Molecular Formula | C24H24F3NO2 |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | (4S)-6-amino-4-methyl-1-[5-[4-(trifluoromethyl)phenoxy]naphthalen-2-yl]hexan-1-one |
| SMILES | C[C@H](CCN)CCC(=O)c1ccc2c(Oc3ccc(C(F)(F)F)cc3)cccc2c1 |
| InChI | InChI=1S/C24H24F3NO2/c1-16(13-14-28)5-12-22(29)18-6-11-21-17(15-18)3-2-4-23(21)30-20-9-7-19(8-10-20)24(25,26)27/h2-4,6-11,15-16H,5,12-14,28H2,1H3/t16-/m0/s1 |
| InChIKey | JXIBJJFSQUEUET-INIZCTEOSA-N |
| XLogP | 6.60 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |