C26H21ClF3NO2 — CID 155713238
N-[(3Z)-4-chloro-3-ethenylhexa-3,5-dien-2-yl]-5-[4-(trifluoromethyl)phenoxy]naphthalene-2-carboxamide (PubChem CID 155713238) has the molecular formula C26H21ClF3NO2 and a molecular weight of 471.91 g/mol. Its IUPAC name is N-[(3Z)-4-chloro-3-ethenylhexa-3,5-dien-2-yl]-5-[4-(trifluoromethyl)phenoxy]naphthalene-2-carboxamide.
| Compound Name | N-[(3Z)-4-chloro-3-ethenylhexa-3,5-dien-2-yl]-5-[4-(trifluoromethyl)phenoxy]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 155713238 |
| Molecular Formula | C26H21ClF3NO2 |
| Molecular Weight | 471.91 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | N-[(3Z)-4-chloro-3-ethenylhexa-3,5-dien-2-yl]-5-[4-(trifluoromethyl)phenoxy]naphthalene-2-carboxamide |
| SMILES | C=C/C(Cl)=C(\C=C)C(C)NC(=O)c1ccc2c(Oc3ccc(C(F)(F)F)cc3)cccc2c1 |
| InChI | InChI=1S/C26H21ClF3NO2/c1-4-21(23(27)5-2)16(3)31-25(32)18-9-14-22-17(15-18)7-6-8-24(22)33-20-12-10-19(11-13-20)26(28,29)30/h4-16H,1-2H2,3H3,(H,31,32)/b23-21- |
| InChIKey | OELKQTUMHNIKHA-LNVKXUELSA-N |
| XLogP | 7.63 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.91 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|