C23H20F3NO3S — CID 146780230
N-[(E)-4-methylsulfonylbut-3-enyl]-5-[4-(trifluoromethyl)phenyl]naphthalene-2-carboxamide (PubChem CID 146780230) has the molecular formula C23H20F3NO3S and a molecular weight of 447.48 g/mol. Its IUPAC name is N-[(E)-4-methylsulfonylbut-3-enyl]-5-[4-(trifluoromethyl)phenyl]naphthalene-2-carboxamide.
| Compound Name | N-[(E)-4-methylsulfonylbut-3-enyl]-5-[4-(trifluoromethyl)phenyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 146780230 |
| Molecular Formula | C23H20F3NO3S |
| Molecular Weight | 447.48 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | N-[(E)-4-methylsulfonylbut-3-enyl]-5-[4-(trifluoromethyl)phenyl]naphthalene-2-carboxamide |
| SMILES | CS(=O)(=O)/C=C/CCNC(=O)c1ccc2c(-c3ccc(C(F)(F)F)cc3)cccc2c1 |
| InChI | InChI=1S/C23H20F3NO3S/c1-31(29,30)14-3-2-13-27-22(28)18-9-12-21-17(15-18)5-4-6-20(21)16-7-10-19(11-8-16)23(24,25)26/h3-12,14-15H,2,13H2,1H3,(H,27,28)/b14-3+ |
| InChIKey | RTNIHSKAIOSUFY-LZWSPWQCSA-N |
| XLogP | 5.20 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.48 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|