C24H22F3NO3S — CID 167367509
N-[(E)-5-methylsulfonylpent-2-enyl]-5-[4-(trifluoromethyl)phenyl]naphthalene-2-carboxamide (PubChem CID 167367509) has the molecular formula C24H22F3NO3S and a molecular weight of 461.51 g/mol. Its IUPAC name is N-[(E)-5-methylsulfonylpent-2-enyl]-5-[4-(trifluoromethyl)phenyl]naphthalene-2-carboxamide.
| Compound Name | N-[(E)-5-methylsulfonylpent-2-enyl]-5-[4-(trifluoromethyl)phenyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 167367509 |
| Molecular Formula | C24H22F3NO3S |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | N-[(E)-5-methylsulfonylpent-2-enyl]-5-[4-(trifluoromethyl)phenyl]naphthalene-2-carboxamide |
| SMILES | CS(=O)(=O)CC/C=C/CNC(=O)c1ccc2c(-c3ccc(C(F)(F)F)cc3)cccc2c1 |
| InChI | InChI=1S/C24H22F3NO3S/c1-32(30,31)15-4-2-3-14-28-23(29)19-10-13-22-18(16-19)6-5-7-21(22)17-8-11-20(12-9-17)24(25,26)27/h2-3,5-13,16H,4,14-15H2,1H3,(H,28,29)/b3-2+ |
| InChIKey | PFNJXSUXNZNVII-NSCUHMNNSA-N |
| XLogP | 5.25 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|